C17H14N2O3 — CID 92733868
(3R)-3-hydroxy-3-(1H-indol-3-yl)-5-methoxy-1H-indol-2-one (PubChem CID 92733868) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-(1H-indol-3-yl)-5-methoxy-1H-indol-2-one.
| Compound Name | (3R)-3-hydroxy-3-(1H-indol-3-yl)-5-methoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 92733868 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (3R)-3-hydroxy-3-(1H-indol-3-yl)-5-methoxy-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)[C@](O)(c1c[nH]c3ccccc13)C(=O)N2 |
| InChI | InChI=1S/C17H14N2O3/c1-22-10-6-7-15-12(8-10)17(21,16(20)19-15)13-9-18-14-5-3-2-4-11(13)14/h2-9,18,21H,1H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | CZZGAFTVHYMSTL-KRWDZBQOSA-N |
| XLogP | 2.36 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |