C16H12N2O2 — CID 757506
(3S)-3-hydroxy-3-(1H-indol-3-yl)-1H-indol-2-one (PubChem CID 757506) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-(1H-indol-3-yl)-1H-indol-2-one.
| Compound Name | (3S)-3-hydroxy-3-(1H-indol-3-yl)-1H-indol-2-one |
|---|---|
| PubChem CID | 757506 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (3S)-3-hydroxy-3-(1H-indol-3-yl)-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2[C@@]1(O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H12N2O2/c19-15-16(20,11-6-2-4-8-14(11)18-15)12-9-17-13-7-3-1-5-10(12)13/h1-9,17,20H,(H,18,19)/t16-/m1/s1 |
| InChIKey | LLSIEQLHMGACNA-MRXNPFEDSA-N |
| XLogP | 2.36 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |