C21H21N3O4 — CID 23643030
(5R,6R,7R,8R)-6-(4-methoxyphenyl)-7-nitrospiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one (PubChem CID 23643030) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (5R,6R,7R,8R)-6-(4-methoxyphenyl)-7-nitrospiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one.
| Compound Name | (5R,6R,7R,8R)-6-(4-methoxyphenyl)-7-nitrospiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 23643030 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (5R,6R,7R,8R)-6-(4-methoxyphenyl)-7-nitrospiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one |
| SMILES | COc1ccc([C@@H]2[C@@H]([N+](=O)[O-])[C@H]3CCCN3[C@]23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-28-14-10-8-13(9-11-14)18-19(24(26)27)17-7-4-12-23(17)21(18)15-5-2-3-6-16(15)22-20(21)25/h2-3,5-6,8-11,17-19H,4,7,12H2,1H3,(H,22,25)/t17-,18-,19+,21+/m1/s1 |
| InChIKey | ISRLUHSVUYFDMR-BNDYYXHWSA-N |
| XLogP | 2.75 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|