C27H21FN4O2 — CID 139177650
(5R,6R,7R,8R)-6-(4-fluorophenyl)-7-nitrospiro[1,2,3,6,7,8-hexahydropyrrolizine-5,11'-indeno[1,2-b]quinoxaline] (PubChem CID 139177650) has the molecular formula C27H21FN4O2 and a molecular weight of 452.49 g/mol. Its IUPAC name is (5R,6R,7R,8R)-6-(4-fluorophenyl)-7-nitrospiro[1,2,3,6,7,8-hexahydropyrrolizine-5,11'-indeno[1,2-b]quinoxaline].
| Compound Name | (5R,6R,7R,8R)-6-(4-fluorophenyl)-7-nitrospiro[1,2,3,6,7,8-hexahydropyrrolizine-5,11'-indeno[1,2-b]quinoxaline] |
|---|---|
| PubChem CID | 139177650 |
| Molecular Formula | C27H21FN4O2 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (5R,6R,7R,8R)-6-(4-fluorophenyl)-7-nitrospiro[1,2,3,6,7,8-hexahydropyrrolizine-5,11'-indeno[1,2-b]quinoxaline] |
| SMILES | O=[N+]([O-])[C@H]1[C@H]2CCCN2[C@@]2(c3ccccc3-c3nc4ccccc4nc32)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H21FN4O2/c28-17-13-11-16(12-14-17)23-25(32(33)34)22-10-5-15-31(22)27(23)19-7-2-1-6-18(19)24-26(27)30-21-9-4-3-8-20(21)29-24/h1-4,6-9,11-14,22-23,25H,5,10,15H2/t22-,23-,25+,27+/m1/s1 |
| InChIKey | GNSKDSPBPVTZQD-USUFHLAHSA-N |
| XLogP | 4.90 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|