C38H32N4O3 — CID 139085462
CID 139085462 (PubChem CID 139085462) has the molecular formula C38H32N4O3 and a molecular weight of 592.70 g/mol.
| Compound Name | CID 139085462 |
|---|---|
| PubChem CID | 139085462 |
| Molecular Formula | C38H32N4O3 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | — |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CCCN2[C@@]2(C(=O)N(Cc3ccccc3)c3ccccc32)[C@]12c1ccccc1-c1nc3ccccc3nc12 |
| InChI | InChI=1S/C38H32N4O3/c1-2-45-35(43)32-31-21-12-22-42(31)38(27-17-8-11-20-30(27)41(36(38)44)23-24-13-4-3-5-14-24)37(32)26-16-7-6-15-25(26)33-34(37)40-29-19-10-9-18-28(29)39-33/h3-11,13-20,31-32H,2,12,21-23H2,1H3/t31-,32+,37-,38+/m1/s1 |
| InChIKey | PFJRJENRQVSOTO-WAUCDEKUSA-N |
| XLogP | 6.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |