C20H24N2O3 — CID 94785525
ethyl (2R,3R,8R)-2'-oxo-1'-prop-2-enylspiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxylate (PubChem CID 94785525) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is ethyl (2R,3R,8R)-2'-oxo-1'-prop-2-enylspiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxylate.
| Compound Name | ethyl (2R,3R,8R)-2'-oxo-1'-prop-2-enylspiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxylate |
|---|---|
| PubChem CID | 94785525 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | ethyl (2R,3R,8R)-2'-oxo-1'-prop-2-enylspiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxylate |
| SMILES | C=CCN1C(=O)[C@]2(c3ccccc31)[C@H](C(=O)OCC)C[C@H]1CCCN12 |
| InChI | InChI=1S/C20H24N2O3/c1-3-11-21-17-10-6-5-9-15(17)20(19(21)24)16(18(23)25-4-2)13-14-8-7-12-22(14)20/h3,5-6,9-10,14,16H,1,4,7-8,11-13H2,2H3/t14-,16+,20+/m1/s1 |
| InChIKey | JVWYETQZISRLNA-IIMJZQEZSA-N |
| XLogP | 2.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|