C22H22ClN3O2 — CID 22553750
N-(2-chlorophenyl)-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide (PubChem CID 22553750) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide.
| Compound Name | N-(2-chlorophenyl)-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide |
|---|---|
| PubChem CID | 22553750 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-(2-chlorophenyl)-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide |
| SMILES | CN1C(=O)C2(c3ccccc31)C(C(=O)Nc1ccccc1Cl)CC1CCCN12 |
| InChI | InChI=1S/C22H22ClN3O2/c1-25-19-11-5-2-8-15(19)22(21(25)28)16(13-14-7-6-12-26(14)22)20(27)24-18-10-4-3-9-17(18)23/h2-5,8-11,14,16H,6-7,12-13H2,1H3,(H,24,27) |
| InChIKey | AAUFOEWASNSSCQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |