C25H29N5O3 — CID 155901419
(6S,7R,8aR)-7-N,7-N,1'-trimethyl-2'-oxo-2-N-phenylspiro[1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6,3'-indole]-2,7-dicarboxamide (PubChem CID 155901419) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is (6S,7R,8aR)-7-N,7-N,1'-trimethyl-2'-oxo-2-N-phenylspiro[1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6,3'-indole]-2,7-dicarboxamide.
| Compound Name | (6S,7R,8aR)-7-N,7-N,1'-trimethyl-2'-oxo-2-N-phenylspiro[1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6,3'-indole]-2,7-dicarboxamide |
|---|---|
| PubChem CID | 155901419 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (6S,7R,8aR)-7-N,7-N,1'-trimethyl-2'-oxo-2-N-phenylspiro[1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6,3'-indole]-2,7-dicarboxamide |
| SMILES | CN(C)C(=O)[C@@H]1C[C@@H]2CN(C(=O)Nc3ccccc3)CCN2[C@@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C25H29N5O3/c1-27(2)22(31)20-15-18-16-29(24(33)26-17-9-5-4-6-10-17)13-14-30(18)25(20)19-11-7-8-12-21(19)28(3)23(25)32/h4-12,18,20H,13-16H2,1-3H3,(H,26,33)/t18-,20+,25-/m1/s1 |
| InChIKey | VFXYOHZJQLVFRV-KNOQFWTLSA-N |
| XLogP | 2.18 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |