C21H20ClN3O2S — CID 93309666
(3R,6'R,7'aR)-N-(3-chloro-2-methylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide (PubChem CID 93309666) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is (3R,6'R,7'aR)-N-(3-chloro-2-methylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide.
| Compound Name | (3R,6'R,7'aR)-N-(3-chloro-2-methylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide |
|---|---|
| PubChem CID | 93309666 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (3R,6'R,7'aR)-N-(3-chloro-2-methylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)[C@@H]1C[C@@H]2CSCN2[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C21H20ClN3O2S/c1-12-16(22)6-4-8-17(12)23-19(26)15-9-13-10-28-11-25(13)21(15)14-5-2-3-7-18(14)24-20(21)27/h2-8,13,15H,9-11H2,1H3,(H,23,26)(H,24,27)/t13-,15+,21+/m1/s1 |
| InChIKey | QMBJORFCCWELAW-CGSMKXTHSA-N |
| XLogP | 3.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |