C23H24FN3O2 — CID 163318712
(2S,3R,8R)-N-[2-(4-fluorophenyl)ethyl]-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide (PubChem CID 163318712) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is (2S,3R,8R)-N-[2-(4-fluorophenyl)ethyl]-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide.
| Compound Name | (2S,3R,8R)-N-[2-(4-fluorophenyl)ethyl]-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide |
|---|---|
| PubChem CID | 163318712 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (2S,3R,8R)-N-[2-(4-fluorophenyl)ethyl]-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)[C@H]1C[C@H]2CCCN2[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C23H24FN3O2/c24-16-9-7-15(8-10-16)11-12-25-21(28)19-14-17-4-3-13-27(17)23(19)18-5-1-2-6-20(18)26-22(23)29/h1-2,5-10,17,19H,3-4,11-14H2,(H,25,28)(H,26,29)/t17-,19-,23+/m1/s1 |
| InChIKey | WJJMMBOSHMVZBH-BOCKYXSRSA-N |
| XLogP | 2.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |