C20H24N6O2 — CID 163310672
(2R,3R,8R)-2'-oxo-N-[3-(triazol-1-yl)propyl]spiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide (PubChem CID 163310672) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is (2R,3R,8R)-2'-oxo-N-[3-(triazol-1-yl)propyl]spiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide.
| Compound Name | (2R,3R,8R)-2'-oxo-N-[3-(triazol-1-yl)propyl]spiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide |
|---|---|
| PubChem CID | 163310672 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (2R,3R,8R)-2'-oxo-N-[3-(triazol-1-yl)propyl]spiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide |
| SMILES | O=C(NCCCn1ccnn1)[C@@H]1C[C@H]2CCCN2[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C20H24N6O2/c27-18(21-8-4-10-25-12-9-22-24-25)16-13-14-5-3-11-26(14)20(16)15-6-1-2-7-17(15)23-19(20)28/h1-2,6-7,9,12,14,16H,3-5,8,10-11,13H2,(H,21,27)(H,23,28)/t14-,16+,20+/m1/s1 |
| InChIKey | GVPXXGNSZZSBOH-IIMJZQEZSA-N |
| XLogP | 1.12 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|