C18H23N3O3 — CID 163306683
(2R,3R,8R)-N-(2-hydroxyethyl)-N-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide (PubChem CID 163306683) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2R,3R,8R)-N-(2-hydroxyethyl)-N-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide.
| Compound Name | (2R,3R,8R)-N-(2-hydroxyethyl)-N-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide |
|---|---|
| PubChem CID | 163306683 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2R,3R,8R)-N-(2-hydroxyethyl)-N-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide |
| SMILES | CN(CCO)C(=O)[C@@H]1C[C@H]2CCCN2[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H23N3O3/c1-20(9-10-22)16(23)14-11-12-5-4-8-21(12)18(14)13-6-2-3-7-15(13)19-17(18)24/h2-3,6-7,12,14,22H,4-5,8-11H2,1H3,(H,19,24)/t12-,14+,18+/m1/s1 |
| InChIKey | KFZIPPFEOCHTIO-IAISJRAMSA-N |
| XLogP | 0.77 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |