C38H34Cl2N4O2 — CID 162408532
CID 162408532 (PubChem CID 162408532) has the molecular formula C38H34Cl2N4O2 and a molecular weight of 649.62 g/mol.
| Compound Name | CID 162408532 |
|---|---|
| PubChem CID | 162408532 |
| Molecular Formula | C38H34Cl2N4O2 |
| Molecular Weight | 649.62 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | — |
| SMILES | O=C1N(Cc2ccccc2)c2ccc(Cl)cc2[C@@]12N1CCCC1C1CCCN1[C@]21C(=O)N(Cc2ccccc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C38H34Cl2N4O2/c39-27-15-17-31-29(21-27)37(35(45)41(31)23-25-9-3-1-4-10-25)38(44-20-8-14-34(44)33-13-7-19-43(33)37)30-22-28(40)16-18-32(30)42(36(38)46)24-26-11-5-2-6-12-26/h1-6,9-12,15-18,21-22,33-34H,7-8,13-14,19-20,23-24H2/t33?,34?,37-,38-/m1/s1 |
| InChIKey | QHFTVMYFZCOUCA-UCEDFGLBSA-N |
| XLogP | 7.12 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.62 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |