C22H16Cl2N2O3 — CID 19076613
4-[[3-amino-5-chloro-3-(2-chlorophenyl)-2-oxoindol-1-yl]methyl]benzoic acid (PubChem CID 19076613) has the molecular formula C22H16Cl2N2O3 and a molecular weight of 427.29 g/mol. Its IUPAC name is 4-[[3-amino-5-chloro-3-(2-chlorophenyl)-2-oxoindol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[3-amino-5-chloro-3-(2-chlorophenyl)-2-oxoindol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 19076613 |
| Molecular Formula | C22H16Cl2N2O3 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 4-[[3-amino-5-chloro-3-(2-chlorophenyl)-2-oxoindol-1-yl]methyl]benzoic acid |
| SMILES | NC1(c2ccccc2Cl)C(=O)N(Cc2ccc(C(=O)O)cc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C22H16Cl2N2O3/c23-15-9-10-19-17(11-15)22(25,16-3-1-2-4-18(16)24)21(29)26(19)12-13-5-7-14(8-6-13)20(27)28/h1-11H,12,25H2,(H,27,28) |
| InChIKey | JHNHLNFGKJJAOW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |