C35H29N3O — CID 139084211
(4-methylphenyl)-[(1S,2R,3S,8S)-1-phenylspiro[1,2,5,6,7,8-hexahydropyrrolizine-3,11'-indeno[1,2-b]quinoxaline]-2-yl]methanone (PubChem CID 139084211) has the molecular formula C35H29N3O and a molecular weight of 507.64 g/mol. Its IUPAC name is (4-methylphenyl)-[(1S,2R,3S,8S)-1-phenylspiro[1,2,5,6,7,8-hexahydropyrrolizine-3,11'-indeno[1,2-b]quinoxaline]-2-yl]methanone.
| Compound Name | (4-methylphenyl)-[(1S,2R,3S,8S)-1-phenylspiro[1,2,5,6,7,8-hexahydropyrrolizine-3,11'-indeno[1,2-b]quinoxaline]-2-yl]methanone |
|---|---|
| PubChem CID | 139084211 |
| Molecular Formula | C35H29N3O |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | (4-methylphenyl)-[(1S,2R,3S,8S)-1-phenylspiro[1,2,5,6,7,8-hexahydropyrrolizine-3,11'-indeno[1,2-b]quinoxaline]-2-yl]methanone |
| SMILES | Cc1ccc(C(=O)[C@@H]2[C@@H](c3ccccc3)[C@@H]3CCCN3[C@]23c2ccccc2-c2nc4ccccc4nc23)cc1 |
| InChI | InChI=1S/C35H29N3O/c1-22-17-19-24(20-18-22)33(39)31-30(23-10-3-2-4-11-23)29-16-9-21-38(29)35(31)26-13-6-5-12-25(26)32-34(35)37-28-15-8-7-14-27(28)36-32/h2-8,10-15,17-20,29-31H,9,16,21H2,1H3/t29-,30-,31-,35+/m0/s1 |
| InChIKey | UNKOVAJOFZDBSU-WYODCFETSA-N |
| XLogP | 6.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |