C23H18FN3O3 — CID 71591970
(3S,3'S,4'S,5'S)-3'-(4-fluorophenyl)-4'-nitro-5'-phenylspiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 71591970) has the molecular formula C23H18FN3O3 and a molecular weight of 403.41 g/mol. Its IUPAC name is (3S,3'S,4'S,5'S)-3'-(4-fluorophenyl)-4'-nitro-5'-phenylspiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'S,4'S,5'S)-3'-(4-fluorophenyl)-4'-nitro-5'-phenylspiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 71591970 |
| Molecular Formula | C23H18FN3O3 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (3S,3'S,4'S,5'S)-3'-(4-fluorophenyl)-4'-nitro-5'-phenylspiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2ccccc2[C@]12N[C@@H](c1ccccc1)[C@@H]([N+](=O)[O-])[C@@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C23H18FN3O3/c24-16-12-10-14(11-13-16)19-21(27(29)30)20(15-6-2-1-3-7-15)26-23(19)17-8-4-5-9-18(17)25-22(23)28/h1-13,19-21,26H,(H,25,28)/t19-,20-,21-,23+/m0/s1 |
| InChIKey | RBTFRNKAFXLRHY-VVSUKSJXSA-N |
| XLogP | 3.75 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|