C19H18N2O4 — CID 122234586
(2R,3R,4R,5R)-3-nitro-2,4-diphenyl-7-oxa-1-azaspiro[4.4]nonan-6-one (PubChem CID 122234586) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3-nitro-2,4-diphenyl-7-oxa-1-azaspiro[4.4]nonan-6-one.
| Compound Name | (2R,3R,4R,5R)-3-nitro-2,4-diphenyl-7-oxa-1-azaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 122234586 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (2R,3R,4R,5R)-3-nitro-2,4-diphenyl-7-oxa-1-azaspiro[4.4]nonan-6-one |
| SMILES | O=C1OCC[C@]12N[C@H](c1ccccc1)[C@H]([N+](=O)[O-])[C@H]2c1ccccc1 |
| InChI | InChI=1S/C19H18N2O4/c22-18-19(11-12-25-18)15(13-7-3-1-4-8-13)17(21(23)24)16(20-19)14-9-5-2-6-10-14/h1-10,15-17,20H,11-12H2/t15-,16-,17-,19-/m1/s1 |
| InChIKey | JESFINREGSXPRI-YWTNHNAXSA-N |
| XLogP | 2.45 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|