C30H24ClN3O3 — CID 102432889
(3'R,4'S,5'S)-1-benzyl-3'-(4-chlorophenyl)-4'-nitro-5'-phenylspiro[indole-3,2'-pyrrolidine]-2-one (PubChem CID 102432889) has the molecular formula C30H24ClN3O3 and a molecular weight of 509.99 g/mol. Its IUPAC name is (3'R,4'S,5'S)-1-benzyl-3'-(4-chlorophenyl)-4'-nitro-5'-phenylspiro[indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3'R,4'S,5'S)-1-benzyl-3'-(4-chlorophenyl)-4'-nitro-5'-phenylspiro[indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 102432889 |
| Molecular Formula | C30H24ClN3O3 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (3'R,4'S,5'S)-1-benzyl-3'-(4-chlorophenyl)-4'-nitro-5'-phenylspiro[indole-3,2'-pyrrolidine]-2-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccccc2C12N[C@@H](c1ccccc1)[C@@H]([N+](=O)[O-])[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H24ClN3O3/c31-23-17-15-21(16-18-23)26-28(34(36)37)27(22-11-5-2-6-12-22)32-30(26)24-13-7-8-14-25(24)33(29(30)35)19-20-9-3-1-4-10-20/h1-18,26-28,32H,19H2/t26-,27+,28+,30?/m1/s1 |
| InChIKey | AZEQDTLYOBKJLX-PVMOQUKMSA-N |
| XLogP | 5.86 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|