C24H27N3O3 — CID 132552812
(3'R,4'S,5'S)-5'-cyclohexyl-1-methyl-4'-nitro-3'-phenylspiro[indole-3,2'-pyrrolidine]-2-one (PubChem CID 132552812) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (3'R,4'S,5'S)-5'-cyclohexyl-1-methyl-4'-nitro-3'-phenylspiro[indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3'R,4'S,5'S)-5'-cyclohexyl-1-methyl-4'-nitro-3'-phenylspiro[indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 132552812 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (3'R,4'S,5'S)-5'-cyclohexyl-1-methyl-4'-nitro-3'-phenylspiro[indole-3,2'-pyrrolidine]-2-one |
| SMILES | CN1C(=O)C2(N[C@@H](C3CCCCC3)[C@@H]([N+](=O)[O-])[C@H]2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H27N3O3/c1-26-19-15-9-8-14-18(19)24(23(26)28)20(16-10-4-2-5-11-16)22(27(29)30)21(25-24)17-12-6-3-7-13-17/h2,4-5,8-11,14-15,17,20-22,25H,3,6-7,12-13H2,1H3/t20-,21+,22+,24?/m1/s1 |
| InChIKey | UZBLAFWPVXUIJA-PQSRQHIVSA-N |
| XLogP | 3.84 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|