C20H19N3O3 — CID 102111629
(6R,7R)-7-nitro-6-phenylspiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one (PubChem CID 102111629) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is (6R,7R)-7-nitro-6-phenylspiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one.
| Compound Name | (6R,7R)-7-nitro-6-phenylspiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 102111629 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (6R,7R)-7-nitro-6-phenylspiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2ccccc2C12[C@H](c1ccccc1)[C@@H]([N+](=O)[O-])C1CCCN12 |
| InChI | InChI=1S/C20H19N3O3/c24-19-20(14-9-4-5-10-15(14)21-19)17(13-7-2-1-3-8-13)18(23(25)26)16-11-6-12-22(16)20/h1-5,7-10,16-18H,6,11-12H2,(H,21,24)/t16?,17-,18+,20?/m1/s1 |
| InChIKey | YINCEYBMSIPJQY-NNVNDSJASA-N |
| XLogP | 2.74 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|