C21H21N3O4 — CID 135012461
(6'S,7'R,8'S)-6'-(hydroxymethyl)-6'-nitro-7'-phenylspiro[1H-indole-3,5'-2,3,7,8-tetrahydro-1H-pyrrolizine]-2-one (PubChem CID 135012461) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (6'S,7'R,8'S)-6'-(hydroxymethyl)-6'-nitro-7'-phenylspiro[1H-indole-3,5'-2,3,7,8-tetrahydro-1H-pyrrolizine]-2-one.
| Compound Name | (6'S,7'R,8'S)-6'-(hydroxymethyl)-6'-nitro-7'-phenylspiro[1H-indole-3,5'-2,3,7,8-tetrahydro-1H-pyrrolizine]-2-one |
|---|---|
| PubChem CID | 135012461 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (6'S,7'R,8'S)-6'-(hydroxymethyl)-6'-nitro-7'-phenylspiro[1H-indole-3,5'-2,3,7,8-tetrahydro-1H-pyrrolizine]-2-one |
| SMILES | O=C1Nc2ccccc2C12N1CCC[C@H]1[C@@H](c1ccccc1)[C@]2(CO)[N+](=O)[O-] |
| InChI | InChI=1S/C21H21N3O4/c25-13-20(24(27)28)18(14-7-2-1-3-8-14)17-11-6-12-23(17)21(20)15-9-4-5-10-16(15)22-19(21)26/h1-5,7-10,17-18,25H,6,11-13H2,(H,22,26)/t17-,18+,20-,21?/m0/s1 |
| InChIKey | BSURMYHURSPCGE-PFTCBEMASA-N |
| XLogP | 2.10 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|