C21H21N3O4 — CID 177493745
(3S,3'R,4'R,5'S)-1'-hydroxy-4'-(nitromethyl)-5'-phenyl-3'-prop-1-en-2-ylspiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 177493745) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (3S,3'R,4'R,5'S)-1'-hydroxy-4'-(nitromethyl)-5'-phenyl-3'-prop-1-en-2-ylspiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'R,4'R,5'S)-1'-hydroxy-4'-(nitromethyl)-5'-phenyl-3'-prop-1-en-2-ylspiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 177493745 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (3S,3'R,4'R,5'S)-1'-hydroxy-4'-(nitromethyl)-5'-phenyl-3'-prop-1-en-2-ylspiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | C=C(C)[C@H]1[C@H](C[N+](=O)[O-])[C@@H](c2ccccc2)N(O)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C21H21N3O4/c1-13(2)18-15(12-23(26)27)19(14-8-4-3-5-9-14)24(28)21(18)16-10-6-7-11-17(16)22-20(21)25/h3-11,15,18-19,28H,1,12H2,2H3,(H,22,25)/t15-,18-,19+,21+/m0/s1 |
| InChIKey | HVISWSJQIDQBOY-XJRBWHPUSA-N |
| XLogP | 3.37 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|