C25H21N3O4 — CID 44667791
3'-benzoyl-1'-methyl-4'-(4-nitrophenyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 44667791) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is 3'-benzoyl-1'-methyl-4'-(4-nitrophenyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | 3'-benzoyl-1'-methyl-4'-(4-nitrophenyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 44667791 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 3'-benzoyl-1'-methyl-4'-(4-nitrophenyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | CN1CC(c2ccc([N+](=O)[O-])cc2)C(C(=O)c2ccccc2)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C25H21N3O4/c1-27-15-19(16-11-13-18(14-12-16)28(31)32)22(23(29)17-7-3-2-4-8-17)25(27)20-9-5-6-10-21(20)26-24(25)30/h2-14,19,22H,15H2,1H3,(H,26,30) |
| InChIKey | FRFBDFBDAODCNX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|