C25H22N4O5 — CID 40807837
(3S,3'S,4'R)-5-methoxy-1'-methyl-4'-(3-nitrophenyl)-3'-(pyridine-4-carbonyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 40807837) has the molecular formula C25H22N4O5 and a molecular weight of 458.47 g/mol. Its IUPAC name is (3S,3'S,4'R)-5-methoxy-1'-methyl-4'-(3-nitrophenyl)-3'-(pyridine-4-carbonyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'S,4'R)-5-methoxy-1'-methyl-4'-(3-nitrophenyl)-3'-(pyridine-4-carbonyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 40807837 |
| Molecular Formula | C25H22N4O5 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (3S,3'S,4'R)-5-methoxy-1'-methyl-4'-(3-nitrophenyl)-3'-(pyridine-4-carbonyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | COc1ccc2c(c1)[C@]1(C(=O)N2)[C@@H](C(=O)c2ccncc2)[C@H](c2cccc([N+](=O)[O-])c2)CN1C |
| InChI | InChI=1S/C25H22N4O5/c1-28-14-19(16-4-3-5-17(12-16)29(32)33)22(23(30)15-8-10-26-11-9-15)25(28)20-13-18(34-2)6-7-21(20)27-24(25)31/h3-13,19,22H,14H2,1-2H3,(H,27,31)/t19-,22+,25+/m0/s1 |
| InChIKey | ONSLGYPPXYOJSG-UWUFEASWSA-N |
| XLogP | 3.37 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|