C28H22ClN3O3 — CID 122186279
CID 122186279 (PubChem CID 122186279) has the molecular formula C28H22ClN3O3 and a molecular weight of 483.96 g/mol.
| Compound Name | CID 122186279 |
|---|---|
| PubChem CID | 122186279 |
| Molecular Formula | C28H22ClN3O3 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | — |
| SMILES | O=C1OC(c2ccccc2)=N[C@@]12[C@H](c1cccc(Cl)c1)[C@H]1CCCN1[C@]21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C28H22ClN3O3/c29-19-11-6-10-18(16-19)23-22-14-7-15-32(22)28(20-12-4-5-13-21(20)30-25(28)33)27(23)26(34)35-24(31-27)17-8-2-1-3-9-17/h1-6,8-13,16,22-23H,7,14-15H2,(H,30,33)/t22-,23-,27+,28-/m1/s1 |
| InChIKey | NSOZPVYFUABWBN-SFUJYVBYSA-N |
| XLogP | 4.49 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |