About CID 11060611
CID 11060611 (PubChem CID 11060611) has the molecular formula C35H30N2O4
and a molecular weight of 542.64 g/mol.
Molecular Properties
| Compound Name | CID 11060611 |
| PubChem CID | 11060611 |
| Molecular Formula | C35H30N2O4 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | — |
| SMILES | COc1ccc([C@@H]2[C@H]3CCCN3[C@@]3(C(=O)Nc4ccccc43)[C@]23C(=O)c2ccccc2OC3c2ccccc2)cc1 |
| InChI | InChI=1S/C35H30N2O4/c1-40-24-19-17-22(18-20-24)30-28-15-9-21-37(28)35(26-13-6-7-14-27(26)36-33(35)39)34(30)31(38)25-12-5-8-16-29(25)41-32(34)23-10-3-2-4-11-23/h2-8,10-14,16-20,28,30,32H,9,15,21H2,1H3,(H,36,39)/t28-,30-,32?,34+,35+/m1/s1 |
| InChIKey | VLSJZIMCLIPGLA-DAAXGESKSA-N |
| XLogP | 6.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 11060611 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11060611?
The IUPAC name of CID 11060611 (CID 11060611) is not available.
What is the SMILES notation for CID 11060611?
The canonical SMILES for CID 11060611 is COc1ccc([C@@H]2[C@H]3CCCN3[C@@]3(C(=O)Nc4ccccc43)[C@]23C(=O)c2ccccc2OC3c2ccccc2)cc1.
What is the InChIKey of CID 11060611?
The InChIKey is VLSJZIMCLIPGLA-DAAXGESKSA-N. The full InChI is InChI=1S/C35H30N2O4/c1-40-24-19-17-22(18-20-24)30-28-15-9-21-37(28)35(26-13-6-7-14-27(26)36-33(35)39)34(30)31(38)25-12-5-8-16-29(25)41-32(34)23-10-3-2-4-11-23/h2-8,10-14,16-20,28,30,32H,9,15,21H2,1H3,(H,36,39)/t28-,30-,32?,34+,35+/m1/s1.
What are the key properties of CID 11060611?
CID 11060611 has a molecular weight of 542.64 g/mol, XLogP of 6.11, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11060611 is sourced from PubChem (CID 11060611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).