C35H30N2O4 — CID 11060611
CID 11060611 (PubChem CID 11060611) has the molecular formula C35H30N2O4 and a molecular weight of 542.64 g/mol.
| Compound Name | CID 11060611 |
|---|---|
| PubChem CID | 11060611 |
| Molecular Formula | C35H30N2O4 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | — |
| SMILES | COc1ccc([C@@H]2[C@H]3CCCN3[C@@]3(C(=O)Nc4ccccc43)[C@]23C(=O)c2ccccc2OC3c2ccccc2)cc1 |
| InChI | InChI=1S/C35H30N2O4/c1-40-24-19-17-22(18-20-24)30-28-15-9-21-37(28)35(26-13-6-7-14-27(26)36-33(35)39)34(30)31(38)25-12-5-8-16-29(25)41-32(34)23-10-3-2-4-11-23/h2-8,10-14,16-20,28,30,32H,9,15,21H2,1H3,(H,36,39)/t28-,30-,32?,34+,35+/m1/s1 |
| InChIKey | VLSJZIMCLIPGLA-DAAXGESKSA-N |
| XLogP | 6.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |