C22H19ClN4O3 — CID 102361991
CID 102361991 (PubChem CID 102361991) has the molecular formula C22H19ClN4O3 and a molecular weight of 422.87 g/mol.
| Compound Name | CID 102361991 |
|---|---|
| PubChem CID | 102361991 |
| Molecular Formula | C22H19ClN4O3 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | — |
| SMILES | O=C1NC(=O)[C@@]2(N1)C(c1cccc(Cl)c1)[C@H]1CCCN1[C@]21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C22H19ClN4O3/c23-13-6-3-5-12(11-13)17-16-9-4-10-27(16)22(21(17)18(28)25-20(30)26-21)14-7-1-2-8-15(14)24-19(22)29/h1-3,5-8,11,16-17H,4,9-10H2,(H,24,29)(H2,25,26,28,30)/t16-,17?,21+,22-/m1/s1 |
| InChIKey | RDQJAFWQOSWMIC-UFUXANJMSA-N |
| XLogP | 2.33 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|