C22H18BrFN4O3 — CID 102361984
CID 102361984 (PubChem CID 102361984) has the molecular formula C22H18BrFN4O3 and a molecular weight of 485.31 g/mol.
| Compound Name | CID 102361984 |
|---|---|
| PubChem CID | 102361984 |
| Molecular Formula | C22H18BrFN4O3 |
| Molecular Weight | 485.31 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | — |
| SMILES | O=C1NC(=O)[C@@]2(N1)C(c1ccc(Br)cc1)[C@H]1CCCN1[C@]21C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C22H18BrFN4O3/c23-12-5-3-11(4-6-12)17-16-2-1-9-28(16)22(21(17)18(29)26-20(31)27-21)14-10-13(24)7-8-15(14)25-19(22)30/h3-8,10,16-17H,1-2,9H2,(H,25,30)(H2,26,27,29,31)/t16-,17?,21+,22-/m1/s1 |
| InChIKey | YQALZXKXGWFDBE-UFUXANJMSA-N |
| XLogP | 2.58 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|