About CID 177450841
CID 177450841 (PubChem CID 177450841) has the molecular formula C32H25ClN2O
and a molecular weight of 489.02 g/mol.
Molecular Properties
| Compound Name | CID 177450841 |
| PubChem CID | 177450841 |
| Molecular Formula | C32H25ClN2O |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | — |
| SMILES | O=C1Nc2ccccc2[C@]12N1CCCC1[C@H](c1ccc(Cl)cc1)C21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H25ClN2O/c33-21-17-15-20(16-18-21)29-28-14-7-19-35(28)32(26-12-5-6-13-27(26)34-30(32)36)31(29)24-10-3-1-8-22(24)23-9-2-4-11-25(23)31/h1-6,8-13,15-18,28-29H,7,14,19H2,(H,34,36)/t28?,29-,32-/m0/s1 |
| InChIKey | XFKJQOYKFREVGO-UHOGFZFASA-N |
| XLogP | 6.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 177450841 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177450841?
The IUPAC name of CID 177450841 (CID 177450841) is not available.
What is the SMILES notation for CID 177450841?
The canonical SMILES for CID 177450841 is O=C1Nc2ccccc2[C@]12N1CCCC1[C@H](c1ccc(Cl)cc1)C21c2ccccc2-c2ccccc21.
What is the InChIKey of CID 177450841?
The InChIKey is XFKJQOYKFREVGO-UHOGFZFASA-N. The full InChI is InChI=1S/C32H25ClN2O/c33-21-17-15-20(16-18-21)29-28-14-7-19-35(28)32(26-12-5-6-13-27(26)34-30(32)36)31(29)24-10-3-1-8-22(24)23-9-2-4-11-25(23)31/h1-6,8-13,15-18,28-29H,7,14,19H2,(H,34,36)/t28?,29-,32-/m0/s1.
What are the key properties of CID 177450841?
CID 177450841 has a molecular weight of 489.02 g/mol, XLogP of 6.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177450841 is sourced from PubChem (CID 177450841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).