C33H25ClN2O3 — CID 101205928
CID 101205928 (PubChem CID 101205928) has the molecular formula C33H25ClN2O3 and a molecular weight of 533.03 g/mol.
| Compound Name | CID 101205928 |
|---|---|
| PubChem CID | 101205928 |
| Molecular Formula | C33H25ClN2O3 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | — |
| SMILES | O=C1Nc2ccccc2[C@]12N1Cc3ccccc3C[C@H]1[C@H](c1ccc(Cl)cc1)[C@]21COc2ccccc2C1=O |
| InChI | InChI=1S/C33H25ClN2O3/c34-23-15-13-20(14-16-23)29-27-17-21-7-1-2-8-22(21)18-36(27)33(25-10-4-5-11-26(25)35-31(33)38)32(29)19-39-28-12-6-3-9-24(28)30(32)37/h1-16,27,29H,17-19H2,(H,35,38)/t27-,29-,32-,33-/m0/s1 |
| InChIKey | BZRWEFLFDWXPHF-YHUHDQSOSA-N |
| XLogP | 5.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |