About CID 101205928
CID 101205928 (PubChem CID 101205928) has the molecular formula C33H25ClN2O3
and a molecular weight of 533.03 g/mol.
Molecular Properties
| Compound Name | CID 101205928 |
| PubChem CID | 101205928 |
| Molecular Formula | C33H25ClN2O3 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | — |
| SMILES | O=C1Nc2ccccc2[C@]12N1Cc3ccccc3C[C@H]1[C@H](c1ccc(Cl)cc1)[C@]21COc2ccccc2C1=O |
| InChI | InChI=1S/C33H25ClN2O3/c34-23-15-13-20(14-16-23)29-27-17-21-7-1-2-8-22(21)18-36(27)33(25-10-4-5-11-26(25)35-31(33)38)32(29)19-39-28-12-6-3-9-24(28)30(32)37/h1-16,27,29H,17-19H2,(H,35,38)/t27-,29-,32-,33-/m0/s1 |
| InChIKey | BZRWEFLFDWXPHF-YHUHDQSOSA-N |
| XLogP | 5.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 101205928 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101205928?
The IUPAC name of CID 101205928 (CID 101205928) is not available.
What is the SMILES notation for CID 101205928?
The canonical SMILES for CID 101205928 is O=C1Nc2ccccc2[C@]12N1Cc3ccccc3C[C@H]1[C@H](c1ccc(Cl)cc1)[C@]21COc2ccccc2C1=O.
What is the InChIKey of CID 101205928?
The InChIKey is BZRWEFLFDWXPHF-YHUHDQSOSA-N. The full InChI is InChI=1S/C33H25ClN2O3/c34-23-15-13-20(14-16-23)29-27-17-21-7-1-2-8-22(21)18-36(27)33(25-10-4-5-11-26(25)35-31(33)38)32(29)19-39-28-12-6-3-9-24(28)30(32)37/h1-16,27,29H,17-19H2,(H,35,38)/t27-,29-,32-,33-/m0/s1.
What are the key properties of CID 101205928?
CID 101205928 has a molecular weight of 533.03 g/mol, XLogP of 5.97, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101205928 is sourced from PubChem (CID 101205928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).