C24H18Cl2N2O2 — CID 141183567
1',6'-bis(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 141183567) has the molecular formula C24H18Cl2N2O2 and a molecular weight of 437.33 g/mol. Its IUPAC name is 1',6'-bis(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | 1',6'-bis(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 141183567 |
| Molecular Formula | C24H18Cl2N2O2 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 1',6'-bis(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | O=C1CCC2(C(=O)Nc3ccccc32)C(c2cccc(Cl)c2)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H18Cl2N2O2/c25-16-6-3-5-15(13-16)22-24(19-9-1-2-10-20(19)27-23(24)30)12-11-21(29)28(22)18-8-4-7-17(26)14-18/h1-10,13-14,22H,11-12H2,(H,27,30) |
| InChIKey | DIZIUIUFGAFJKN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |