C24H17Cl3N2O2 — CID 141183541
1'-chloro-6'-(2-chlorophenyl)-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 141183541) has the molecular formula C24H17Cl3N2O2 and a molecular weight of 471.77 g/mol. Its IUPAC name is 1'-chloro-6'-(2-chlorophenyl)-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | 1'-chloro-6'-(2-chlorophenyl)-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 141183541 |
| Molecular Formula | C24H17Cl3N2O2 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 1'-chloro-6'-(2-chlorophenyl)-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | O=C1CC(c2cccc(Cl)c2)C2(C(=O)Nc3ccccc32)C(c2ccccc2Cl)N1Cl |
| InChI | InChI=1S/C24H17Cl3N2O2/c25-15-7-5-6-14(12-15)18-13-21(30)29(27)22(16-8-1-3-10-19(16)26)24(18)17-9-2-4-11-20(17)28-23(24)31/h1-12,18,22H,13H2,(H,28,31) |
| InChIKey | VAVXAJCRFZAIOS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|