C20H15ClN2O — CID 2507080
(2S)-2-(3-chlorophenyl)-3-phenyl-1,2-dihydroquinazolin-4-one (PubChem CID 2507080) has the molecular formula C20H15ClN2O and a molecular weight of 334.81 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenyl)-3-phenyl-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-2-(3-chlorophenyl)-3-phenyl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 2507080 |
| Molecular Formula | C20H15ClN2O |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (2S)-2-(3-chlorophenyl)-3-phenyl-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@H](c2cccc(Cl)c2)N1c1ccccc1 |
| InChI | InChI=1S/C20H15ClN2O/c21-15-8-6-7-14(13-15)19-22-18-12-5-4-11-17(18)20(24)23(19)16-9-2-1-3-10-16/h1-13,19,22H/t19-/m0/s1 |
| InChIKey | HUWYPPUQHWDVPS-IBGZPJMESA-N |
| XLogP | 5.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |