About (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one
(2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 25408198) has the molecular formula C20H15ClN2O3
and a molecular weight of 366.80 g/mol. Its IUPAC name is (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one.
Molecular Properties
| Compound Name | (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one |
| PubChem CID | 25408198 |
| Molecular Formula | C20H15ClN2O3 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@H](c2ccc(O)c(O)c2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClN2O3/c21-13-6-8-14(9-7-13)23-19(12-5-10-17(24)18(25)11-12)22-16-4-2-1-3-15(16)20(23)26/h1-11,19,22,24-25H/t19-/m0/s1 |
| InChIKey | FLOLNFFZBVGROL-IBGZPJMESA-N |
| XLogP | 4.52 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one?
The IUPAC name of (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one (CID 25408198) is (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one.
What is the SMILES notation for (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one?
The canonical SMILES for (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one is O=C1c2ccccc2N[C@H](c2ccc(O)c(O)c2)N1c1ccc(Cl)cc1.
What is the InChIKey of (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one?
The InChIKey is FLOLNFFZBVGROL-IBGZPJMESA-N. The full InChI is InChI=1S/C20H15ClN2O3/c21-13-6-8-14(9-7-13)23-19(12-5-10-17(24)18(25)11-12)22-16-4-2-1-3-15(16)20(23)26/h1-11,19,22,24-25H/t19-/m0/s1.
What are the key properties of (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one?
(2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one has a molecular weight of 366.80 g/mol, XLogP of 4.52, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(4-chlorophenyl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one is sourced from PubChem (CID 25408198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).