C27H23FN2O3 — CID 171391942
(5R,6R,7S,8S)-6-(4-fluorophenyl)-7-(4-hydroxybenzoyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one (PubChem CID 171391942) has the molecular formula C27H23FN2O3 and a molecular weight of 442.49 g/mol. Its IUPAC name is (5R,6R,7S,8S)-6-(4-fluorophenyl)-7-(4-hydroxybenzoyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one.
| Compound Name | (5R,6R,7S,8S)-6-(4-fluorophenyl)-7-(4-hydroxybenzoyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 171391942 |
| Molecular Formula | C27H23FN2O3 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (5R,6R,7S,8S)-6-(4-fluorophenyl)-7-(4-hydroxybenzoyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one |
| SMILES | O=C(c1ccc(O)cc1)[C@@H]1[C@@H]2CCCN2[C@]2(C(=O)Nc3ccccc32)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H23FN2O3/c28-18-11-7-16(8-12-18)24-23(25(32)17-9-13-19(31)14-10-17)22-6-3-15-30(22)27(24)20-4-1-2-5-21(20)29-26(27)33/h1-2,4-5,7-14,22-24,31H,3,6,15H2,(H,29,33)/t22-,23+,24-,27-/m0/s1 |
| InChIKey | YEOJZQJOABQQDU-LAOBSVPGSA-N |
| XLogP | 4.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |