C17H24N2O2 — CID 165368297
7,7-dimethyl-9-nitro-8-phenyl-1,2,3,4,6,8,9,9a-octahydroquinolizine (PubChem CID 165368297) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 7,7-dimethyl-9-nitro-8-phenyl-1,2,3,4,6,8,9,9a-octahydroquinolizine.
| Compound Name | 7,7-dimethyl-9-nitro-8-phenyl-1,2,3,4,6,8,9,9a-octahydroquinolizine |
|---|---|
| PubChem CID | 165368297 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 7,7-dimethyl-9-nitro-8-phenyl-1,2,3,4,6,8,9,9a-octahydroquinolizine |
| SMILES | CC1(C)CN2CCCCC2C([N+](=O)[O-])C1c1ccccc1 |
| InChI | InChI=1S/C17H24N2O2/c1-17(2)12-18-11-7-6-10-14(18)16(19(20)21)15(17)13-8-4-3-5-9-13/h3-5,8-9,14-16H,6-7,10-12H2,1-2H3 |
| InChIKey | VHKNXOXHQLBQRE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|