C16H21N3O4 — CID 165368296
(7S,8R,8aS)-6,6-dimethyl-8-nitro-7-(4-nitrophenyl)-2,3,5,7,8,8a-hexahydro-1H-indolizine (PubChem CID 165368296) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is (7S,8R,8aS)-6,6-dimethyl-8-nitro-7-(4-nitrophenyl)-2,3,5,7,8,8a-hexahydro-1H-indolizine.
| Compound Name | (7S,8R,8aS)-6,6-dimethyl-8-nitro-7-(4-nitrophenyl)-2,3,5,7,8,8a-hexahydro-1H-indolizine |
|---|---|
| PubChem CID | 165368296 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (7S,8R,8aS)-6,6-dimethyl-8-nitro-7-(4-nitrophenyl)-2,3,5,7,8,8a-hexahydro-1H-indolizine |
| SMILES | CC1(C)CN2CCC[C@H]2[C@H]([N+](=O)[O-])[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H21N3O4/c1-16(2)10-17-9-3-4-13(17)15(19(22)23)14(16)11-5-7-12(8-6-11)18(20)21/h5-8,13-15H,3-4,9-10H2,1-2H3/t13-,14+,15-/m0/s1 |
| InChIKey | HVCZROMYMRPLBD-ZNMIVQPWSA-N |
| XLogP | 2.83 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|