C10H9Br2NO2 — CID 914874
1-[(1S,3S)-2,2-dibromo-3-methylcyclopropyl]-4-nitrobenzene (PubChem CID 914874) has the molecular formula C10H9Br2NO2 and a molecular weight of 335.00 g/mol. Its IUPAC name is 1-[(1S,3S)-2,2-dibromo-3-methylcyclopropyl]-4-nitrobenzene.
| Compound Name | 1-[(1S,3S)-2,2-dibromo-3-methylcyclopropyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 914874 |
| Molecular Formula | C10H9Br2NO2 |
| Molecular Weight | 335.00 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | 1-[(1S,3S)-2,2-dibromo-3-methylcyclopropyl]-4-nitrobenzene |
| SMILES | C[C@H]1[C@@H](c2ccc([N+](=O)[O-])cc2)C1(Br)Br |
| InChI | InChI=1S/C10H9Br2NO2/c1-6-9(10(6,11)12)7-2-4-8(5-3-7)13(14)15/h2-6,9H,1H3/t6-,9-/m0/s1 |
| InChIKey | OJUKEDPMMWQXBR-RCOVLWMOSA-N |
| XLogP | 3.81 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.00 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|