C19H20N3O5+ — CID 7409601
(2S,3S,5S,6S)-3,5-dimethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-one (PubChem CID 7409601) has the molecular formula C19H20N3O5+ and a molecular weight of 370.39 g/mol. Its IUPAC name is (2S,3S,5S,6S)-3,5-dimethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-one.
| Compound Name | (2S,3S,5S,6S)-3,5-dimethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-one |
|---|---|
| PubChem CID | 7409601 |
| Molecular Formula | C19H20N3O5+ |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2S,3S,5S,6S)-3,5-dimethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-one |
| SMILES | C[C@@H]1C(=O)[C@@H](C)[C@@H](c2ccc([N+](=O)[O-])cc2)[NH2+]C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N3O5/c1-11-17(13-3-7-15(8-4-13)21(24)25)20-18(12(2)19(11)23)14-5-9-16(10-6-14)22(26)27/h3-12,17-18,20H,1-2H3/p+1/t11-,12-,17-,18?/m0/s1 |
| InChIKey | IVZWWWWEWLNVOI-DKZLQSCXSA-O |
| XLogP | 2.70 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|