C12H14N2O4S — CID 6928356
(2S,4R)-5,5-dimethyl-2-(4-nitrophenyl)-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 6928356) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is (2S,4R)-5,5-dimethyl-2-(4-nitrophenyl)-1,3-thiazolidin-3-ium-4-carboxylate.
| Compound Name | (2S,4R)-5,5-dimethyl-2-(4-nitrophenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 6928356 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (2S,4R)-5,5-dimethyl-2-(4-nitrophenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | CC1(C)S[C@@H](c2ccc([N+](=O)[O-])cc2)[NH2+][C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C12H14N2O4S/c1-12(2)9(11(15)16)13-10(19-12)7-3-5-8(6-4-7)14(17)18/h3-6,9-10,13H,1-2H3,(H,15,16)/t9-,10+/m1/s1 |
| InChIKey | OGHPTFQLKPPMPJ-ZJUUUORDSA-N |
| XLogP | -0.20 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|