C14H15N2O5S- — CID 6928410
(2S,4S)-3-acetyl-5,5-dimethyl-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 6928410) has the molecular formula C14H15N2O5S- and a molecular weight of 323.35 g/mol. Its IUPAC name is (2S,4S)-3-acetyl-5,5-dimethyl-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | (2S,4S)-3-acetyl-5,5-dimethyl-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 6928410 |
| Molecular Formula | C14H15N2O5S- |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (2S,4S)-3-acetyl-5,5-dimethyl-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CC(=O)N1[C@@H](C(=O)[O-])C(C)(C)S[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H16N2O5S/c1-8(17)15-11(13(18)19)14(2,3)22-12(15)9-4-6-10(7-5-9)16(20)21/h4-7,11-12H,1-3H3,(H,18,19)/p-1/t11-,12-/m0/s1 |
| InChIKey | NFMGOYWXMFHNAO-RYUDHWBXSA-M |
| XLogP | 1.09 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|