C17H19N3O6S — CID 54554375
(2S,5R)-3,3,6-trimethyl-6-[[2-(4-nitrophenyl)acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 54554375) has the molecular formula C17H19N3O6S and a molecular weight of 393.42 g/mol. Its IUPAC name is (2S,5R)-3,3,6-trimethyl-6-[[2-(4-nitrophenyl)acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-3,3,6-trimethyl-6-[[2-(4-nitrophenyl)acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 54554375 |
| Molecular Formula | C17H19N3O6S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (2S,5R)-3,3,6-trimethyl-6-[[2-(4-nitrophenyl)acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@H]2N(C(=O)C2(C)NC(=O)Cc2ccc([N+](=O)[O-])cc2)[C@H]1C(=O)O |
| InChI | InChI=1S/C17H19N3O6S/c1-16(2)12(13(22)23)19-14(24)17(3,15(19)27-16)18-11(21)8-9-4-6-10(7-5-9)20(25)26/h4-7,12,15H,8H2,1-3H3,(H,18,21)(H,22,23)/t12-,15+,17?/m0/s1 |
| InChIKey | ZMCZSCYPOSWMOM-AJAMINHISA-N |
| XLogP | 1.16 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|