C16H17N3O6S — CID 54558952
(2S,5R)-3,3,6-trimethyl-6-[(2-nitrobenzoyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 54558952) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is (2S,5R)-3,3,6-trimethyl-6-[(2-nitrobenzoyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-3,3,6-trimethyl-6-[(2-nitrobenzoyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 54558952 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (2S,5R)-3,3,6-trimethyl-6-[(2-nitrobenzoyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@H]2N(C(=O)C2(C)NC(=O)c2ccccc2[N+](=O)[O-])[C@H]1C(=O)O |
| InChI | InChI=1S/C16H17N3O6S/c1-15(2)10(12(21)22)18-13(23)16(3,14(18)26-15)17-11(20)8-6-4-5-7-9(8)19(24)25/h4-7,10,14H,1-3H3,(H,17,20)(H,21,22)/t10-,14+,16?/m0/s1 |
| InChIKey | ZPEABUICYWLFLA-RHKOVIJRSA-N |
| XLogP | 1.23 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|