C19H20N4O6S — CID 22802178
(2S,5R,6S)-3,3,6-trimethyl-6-[[5-methyl-3-(2-nitrophenyl)-1,2-oxazol-4-yl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 22802178) has the molecular formula C19H20N4O6S and a molecular weight of 432.46 g/mol. Its IUPAC name is (2S,5R,6S)-3,3,6-trimethyl-6-[[5-methyl-3-(2-nitrophenyl)-1,2-oxazol-4-yl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6S)-3,3,6-trimethyl-6-[[5-methyl-3-(2-nitrophenyl)-1,2-oxazol-4-yl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 22802178 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (2S,5R,6S)-3,3,6-trimethyl-6-[[5-methyl-3-(2-nitrophenyl)-1,2-oxazol-4-yl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | Cc1onc(-c2ccccc2[N+](=O)[O-])c1N[C@@]1(C)C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@@H]21 |
| InChI | InChI=1S/C19H20N4O6S/c1-9-12(13(21-29-9)10-7-5-6-8-11(10)23(27)28)20-19(4)16(26)22-14(15(24)25)18(2,3)30-17(19)22/h5-8,14,17,20H,1-4H3,(H,24,25)/t14-,17+,19-/m0/s1 |
| InChIKey | BWURFNXWOZDBBU-YJLNNSPDSA-N |
| XLogP | 2.88 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|