C23H25N3O9S — CID 175016837
butanedioic acid;(2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 175016837) has the molecular formula C23H25N3O9S and a molecular weight of 519.53 g/mol. Its IUPAC name is butanedioic acid;(2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | butanedioic acid;(2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 175016837 |
| Molecular Formula | C23H25N3O9S |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | butanedioic acid;(2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)N[C@@H]1C(=O)N2[C@@H]1SC(C)(C)[C@@H]2C(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C19H19N3O5S.C4H6O4/c1-9-11(12(21-27-9)10-7-5-4-6-8-10)15(23)20-13-16(24)22-14(18(25)26)19(2,3)28-17(13)22;5-3(6)1-2-4(7)8/h4-8,13-14,17H,1-3H3,(H,20,23)(H,25,26);1-2H2,(H,5,6)(H,7,8)/t13-,14+,17-;/m1./s1 |
| InChIKey | LDCPGCAUVBTGTO-SLINCCQESA-N |
| XLogP | 1.83 |
| TPSA | 187.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |