C19H21N3NaO6S — CID 18531013
CID 18531013 (PubChem CID 18531013) has the molecular formula C19H21N3NaO6S and a molecular weight of 442.45 g/mol.
| Compound Name | CID 18531013 |
|---|---|
| PubChem CID | 18531013 |
| Molecular Formula | C19H21N3NaO6S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | — |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)N[C@@H]1C(=O)N2[C@@H]1SC(C)(C)[C@@H]2C(=O)O.O.[Na] |
| InChI | InChI=1S/C19H19N3O5S.Na.H2O/c1-9-11(12(21-27-9)10-7-5-4-6-8-10)15(23)20-13-16(24)22-14(18(25)26)19(2,3)28-17(13)22;;/h4-8,13-14,17H,1-3H3,(H,20,23)(H,25,26);;1H2/t13-,14+,17-;;/m1../s1 |
| InChIKey | SNNRZFMTISMWEY-VICXVTCVSA-N |
| XLogP | 0.69 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |