C15H14BrNO4S — CID 11132769
(2S,5R,6R)-6-benzoyl-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 11132769) has the molecular formula C15H14BrNO4S and a molecular weight of 384.25 g/mol. Its IUPAC name is (2S,5R,6R)-6-benzoyl-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-benzoyl-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 11132769 |
| Molecular Formula | C15H14BrNO4S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | (2S,5R,6R)-6-benzoyl-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@H]2N(C(=O)[C@]2(Br)C(=O)c2ccccc2)[C@H]1C(=O)O |
| InChI | InChI=1S/C15H14BrNO4S/c1-14(2)9(11(19)20)17-12(21)15(16,13(17)22-14)10(18)8-6-4-3-5-7-8/h3-7,9,13H,1-2H3,(H,19,20)/t9-,13+,15+/m0/s1 |
| InChIKey | QWNANOBMZANRAX-JBCWJZNQSA-N |
| XLogP | 2.15 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|