C16H15BrFNO5S — CID 57278263
(2S,5R)-6-bromo-6-[2-(4-fluorophenyl)-2-hydroxyacetyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 57278263) has the molecular formula C16H15BrFNO5S and a molecular weight of 432.27 g/mol. Its IUPAC name is (2S,5R)-6-bromo-6-[2-(4-fluorophenyl)-2-hydroxyacetyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-6-bromo-6-[2-(4-fluorophenyl)-2-hydroxyacetyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 57278263 |
| Molecular Formula | C16H15BrFNO5S |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | (2S,5R)-6-bromo-6-[2-(4-fluorophenyl)-2-hydroxyacetyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@H]2N(C(=O)C2(Br)C(=O)C(O)c2ccc(F)cc2)[C@H]1C(=O)O |
| InChI | InChI=1S/C16H15BrFNO5S/c1-15(2)10(12(22)23)19-13(24)16(17,14(19)25-15)11(21)9(20)7-3-5-8(18)6-4-7/h3-6,9-10,14,20H,1-2H3,(H,22,23)/t9?,10-,14+,16?/m0/s1 |
| InChIKey | PDJCAAVOZNYCSW-ILAUIXFOSA-N |
| XLogP | 1.71 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|