C14H20BrNO6S — CID 56631702
(2S,5R)-6-bromo-6-(2-butoxy-1-hydroxy-2-oxoethyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 56631702) has the molecular formula C14H20BrNO6S and a molecular weight of 410.29 g/mol. Its IUPAC name is (2S,5R)-6-bromo-6-(2-butoxy-1-hydroxy-2-oxoethyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-6-bromo-6-(2-butoxy-1-hydroxy-2-oxoethyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 56631702 |
| Molecular Formula | C14H20BrNO6S |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | (2S,5R)-6-bromo-6-(2-butoxy-1-hydroxy-2-oxoethyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CCCCOC(=O)C(O)C1(Br)C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@@H]21 |
| InChI | InChI=1S/C14H20BrNO6S/c1-4-5-6-22-10(20)8(17)14(15)11(21)16-7(9(18)19)13(2,3)23-12(14)16/h7-8,12,17H,4-6H2,1-3H3,(H,18,19)/t7-,8?,12+,14?/m0/s1 |
| InChIKey | FQRKFFLRUAIPGZ-KKDUWRCYSA-N |
| XLogP | 0.97 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|