C15H13BrClN3O5S — CID 57181305
(2S,5R)-6-bromo-6-[[chloro-(3-nitrophenyl)methylidene]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 57181305) has the molecular formula C15H13BrClN3O5S and a molecular weight of 462.71 g/mol. Its IUPAC name is (2S,5R)-6-bromo-6-[[chloro-(3-nitrophenyl)methylidene]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-6-bromo-6-[[chloro-(3-nitrophenyl)methylidene]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 57181305 |
| Molecular Formula | C15H13BrClN3O5S |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 460.94 |
| IUPAC Name | (2S,5R)-6-bromo-6-[[chloro-(3-nitrophenyl)methylidene]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@H]2N(C(=O)C2(Br)N=C(Cl)c2cccc([N+](=O)[O-])c2)[C@H]1C(=O)O |
| InChI | InChI=1S/C15H13BrClN3O5S/c1-14(2)9(11(21)22)19-12(23)15(16,13(19)26-14)18-10(17)7-4-3-5-8(6-7)20(24)25/h3-6,9,13H,1-2H3,(H,21,22)/t9-,13+,15?/m0/s1 |
| InChIKey | WURXBQONKRAYQI-DEOINHEYSA-N |
| XLogP | 2.82 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|